C15H23NO5 — CID 16807424
1-[2-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]phenyl]ethanone (PubChem CID 16807424) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-[2-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]phenyl]ethanone.
| Compound Name | 1-[2-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 16807424 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1-[2-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1OCC(O)CN(CCO)CCO |
| InChI | InChI=1S/C15H23NO5/c1-12(19)14-4-2-3-5-15(14)21-11-13(20)10-16(6-8-17)7-9-18/h2-5,13,17-18,20H,6-11H2,1H3 |
| InChIKey | UANTYFAWWZEVRP-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |