C15H24NO5+ — CID 2142702
[(2R)-3-(2-acetylphenoxy)-2-hydroxypropyl]-bis(2-hydroxyethyl)azanium (PubChem CID 2142702) has the molecular formula C15H24NO5+ and a molecular weight of 298.36 g/mol. Its IUPAC name is [(2R)-3-(2-acetylphenoxy)-2-hydroxypropyl]-bis(2-hydroxyethyl)azanium.
| Compound Name | [(2R)-3-(2-acetylphenoxy)-2-hydroxypropyl]-bis(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 2142702 |
| Molecular Formula | C15H24NO5+ |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [(2R)-3-(2-acetylphenoxy)-2-hydroxypropyl]-bis(2-hydroxyethyl)azanium |
| SMILES | CC(=O)c1ccccc1OC[C@H](O)C[NH+](CCO)CCO |
| InChI | InChI=1S/C15H23NO5/c1-12(19)14-4-2-3-5-15(14)21-11-13(20)10-16(6-8-17)7-9-18/h2-5,13,17-18,20H,6-11H2,1H3/p+1/t13-/m1/s1 |
| InChIKey | UANTYFAWWZEVRP-CYBMUJFWSA-O |
| XLogP | -1.50 |
| TPSA | 91.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |