C21H25N2O3+ — CID 4059822
1-[2-[2-hydroxy-3-(2-propan-2-yl-3H-benzimidazol-1-ium-1-yl)propoxy]phenyl]ethanone (PubChem CID 4059822) has the molecular formula C21H25N2O3+ and a molecular weight of 353.44 g/mol. Its IUPAC name is 1-[2-[2-hydroxy-3-(2-propan-2-yl-3H-benzimidazol-1-ium-1-yl)propoxy]phenyl]ethanone.
| Compound Name | 1-[2-[2-hydroxy-3-(2-propan-2-yl-3H-benzimidazol-1-ium-1-yl)propoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 4059822 |
| Molecular Formula | C21H25N2O3+ |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 1-[2-[2-hydroxy-3-(2-propan-2-yl-3H-benzimidazol-1-ium-1-yl)propoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1OCC(O)C[n+]1c(C(C)C)[nH]c2ccccc21 |
| InChI | InChI=1S/C21H24N2O3/c1-14(2)21-22-18-9-5-6-10-19(18)23(21)12-16(25)13-26-20-11-7-4-8-17(20)15(3)24/h4-11,14,16,25H,12-13H2,1-3H3/p+1 |
| InChIKey | AKRJSLBYMTUSRP-UHFFFAOYSA-O |
| XLogP | 3.22 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|