C18H32NO2+ — CID 2288015
dibutyl-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]azanium (PubChem CID 2288015) has the molecular formula C18H32NO2+ and a molecular weight of 294.46 g/mol. Its IUPAC name is dibutyl-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]azanium.
| Compound Name | dibutyl-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 2288015 |
| Molecular Formula | C18H32NO2+ |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | dibutyl-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]azanium |
| SMILES | CCCC[NH+](CCCC)C[C@@H](O)COc1ccccc1C |
| InChI | InChI=1S/C18H31NO2/c1-4-6-12-19(13-7-5-2)14-17(20)15-21-18-11-9-8-10-16(18)3/h8-11,17,20H,4-7,12-15H2,1-3H3/p+1/t17-/m1/s1 |
| InChIKey | IGOYYRBLQWESAP-QGZVFWFLSA-O |
| XLogP | 2.22 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |