C24H28NO2+ — CID 5040154
dibenzyl-[2-hydroxy-3-(2-methylphenoxy)propyl]azanium (PubChem CID 5040154) has the molecular formula C24H28NO2+ and a molecular weight of 362.49 g/mol. Its IUPAC name is dibenzyl-[2-hydroxy-3-(2-methylphenoxy)propyl]azanium.
| Compound Name | dibenzyl-[2-hydroxy-3-(2-methylphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 5040154 |
| Molecular Formula | C24H28NO2+ |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | dibenzyl-[2-hydroxy-3-(2-methylphenoxy)propyl]azanium |
| SMILES | Cc1ccccc1OCC(O)C[NH+](Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H27NO2/c1-20-10-8-9-15-24(20)27-19-23(26)18-25(16-21-11-4-2-5-12-21)17-22-13-6-3-7-14-22/h2-15,23,26H,16-19H2,1H3/p+1 |
| InChIKey | AWYKEYBLJROOGP-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |