C19H26NO4+ — CID 2046874
benzyl-(2-hydroxyethyl)-[(2S)-2-hydroxy-3-(3-methoxyphenoxy)propyl]azanium (PubChem CID 2046874) has the molecular formula C19H26NO4+ and a molecular weight of 332.42 g/mol. Its IUPAC name is benzyl-(2-hydroxyethyl)-[(2S)-2-hydroxy-3-(3-methoxyphenoxy)propyl]azanium.
| Compound Name | benzyl-(2-hydroxyethyl)-[(2S)-2-hydroxy-3-(3-methoxyphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 2046874 |
| Molecular Formula | C19H26NO4+ |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | benzyl-(2-hydroxyethyl)-[(2S)-2-hydroxy-3-(3-methoxyphenoxy)propyl]azanium |
| SMILES | COc1cccc(OC[C@@H](O)C[NH+](CCO)Cc2ccccc2)c1 |
| InChI | InChI=1S/C19H25NO4/c1-23-18-8-5-9-19(12-18)24-15-17(22)14-20(10-11-21)13-16-6-3-2-4-7-16/h2-9,12,17,21-22H,10-11,13-15H2,1H3/p+1/t17-/m0/s1 |
| InChIKey | KJUZKQOTHAKRDA-KRWDZBQOSA-O |
| XLogP | 0.51 |
| TPSA | 63.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |