C17H30NO4+ — CID 7998347
[(2R)-3-(3-ethylphenoxy)-2-hydroxypropyl]-bis(2-methoxyethyl)azanium (PubChem CID 7998347) has the molecular formula C17H30NO4+ and a molecular weight of 312.43 g/mol. Its IUPAC name is [(2R)-3-(3-ethylphenoxy)-2-hydroxypropyl]-bis(2-methoxyethyl)azanium.
| Compound Name | [(2R)-3-(3-ethylphenoxy)-2-hydroxypropyl]-bis(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 7998347 |
| Molecular Formula | C17H30NO4+ |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | [(2R)-3-(3-ethylphenoxy)-2-hydroxypropyl]-bis(2-methoxyethyl)azanium |
| SMILES | CCc1cccc(OC[C@H](O)C[NH+](CCOC)CCOC)c1 |
| InChI | InChI=1S/C17H29NO4/c1-4-15-6-5-7-17(12-15)22-14-16(19)13-18(8-10-20-2)9-11-21-3/h5-7,12,16,19H,4,8-11,13-14H2,1-3H3/p+1/t16-/m1/s1 |
| InChIKey | KKYYGSMEKXEFPH-MRXNPFEDSA-O |
| XLogP | 0.17 |
| TPSA | 52.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |