C18H22Cl2NO2+ — CID 7157672
benzyl-[(2S)-3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-ethylazanium (PubChem CID 7157672) has the molecular formula C18H22Cl2NO2+ and a molecular weight of 355.29 g/mol. Its IUPAC name is benzyl-[(2S)-3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-ethylazanium.
| Compound Name | benzyl-[(2S)-3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-ethylazanium |
|---|---|
| PubChem CID | 7157672 |
| Molecular Formula | C18H22Cl2NO2+ |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | benzyl-[(2S)-3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-ethylazanium |
| SMILES | CC[NH+](Cc1ccccc1)C[C@H](O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H21Cl2NO2/c1-2-21(11-14-6-4-3-5-7-14)12-16(22)13-23-18-9-8-15(19)10-17(18)20/h3-10,16,22H,2,11-13H2,1H3/p+1/t16-/m0/s1 |
| InChIKey | AGJKXCLKJGOAQN-INIZCTEOSA-O |
| XLogP | 2.84 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |