C18H21Cl2NO2 — CID 4618279
1-[benzyl(ethyl)amino]-3-(2,4-dichlorophenoxy)propan-2-ol (PubChem CID 4618279) has the molecular formula C18H21Cl2NO2 and a molecular weight of 354.28 g/mol. Its IUPAC name is 1-[benzyl(ethyl)amino]-3-(2,4-dichlorophenoxy)propan-2-ol.
| Compound Name | 1-[benzyl(ethyl)amino]-3-(2,4-dichlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 4618279 |
| Molecular Formula | C18H21Cl2NO2 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-[benzyl(ethyl)amino]-3-(2,4-dichlorophenoxy)propan-2-ol |
| SMILES | CCN(Cc1ccccc1)CC(O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H21Cl2NO2/c1-2-21(11-14-6-4-3-5-7-14)12-16(22)13-23-18-9-8-15(19)10-17(18)20/h3-10,16,22H,2,11-13H2,1H3 |
| InChIKey | AGJKXCLKJGOAQN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |