C24H26ClNO3 — CID 46007695
1-[benzyl-[(2-methoxyphenyl)methyl]amino]-3-(4-chlorophenoxy)propan-2-ol (PubChem CID 46007695) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is 1-[benzyl-[(2-methoxyphenyl)methyl]amino]-3-(4-chlorophenoxy)propan-2-ol.
| Compound Name | 1-[benzyl-[(2-methoxyphenyl)methyl]amino]-3-(4-chlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 46007695 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-[benzyl-[(2-methoxyphenyl)methyl]amino]-3-(4-chlorophenoxy)propan-2-ol |
| SMILES | COc1ccccc1CN(Cc1ccccc1)CC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H26ClNO3/c1-28-24-10-6-5-9-20(24)16-26(15-19-7-3-2-4-8-19)17-22(27)18-29-23-13-11-21(25)12-14-23/h2-14,22,27H,15-18H2,1H3 |
| InChIKey | IMOXWCSXCUYQHD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |