C21H28ClNO3 — CID 42682308
1-(4-chlorophenoxy)-3-[(3-methoxyphenyl)methyl-(2-methylpropyl)amino]propan-2-ol (PubChem CID 42682308) has the molecular formula C21H28ClNO3 and a molecular weight of 377.91 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3-[(3-methoxyphenyl)methyl-(2-methylpropyl)amino]propan-2-ol.
| Compound Name | 1-(4-chlorophenoxy)-3-[(3-methoxyphenyl)methyl-(2-methylpropyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 42682308 |
| Molecular Formula | C21H28ClNO3 |
| Molecular Weight | 377.91 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 1-(4-chlorophenoxy)-3-[(3-methoxyphenyl)methyl-(2-methylpropyl)amino]propan-2-ol |
| SMILES | COc1cccc(CN(CC(C)C)CC(O)COc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H28ClNO3/c1-16(2)12-23(13-17-5-4-6-21(11-17)25-3)14-19(24)15-26-20-9-7-18(22)8-10-20/h4-11,16,19,24H,12-15H2,1-3H3 |
| InChIKey | QKNQGQWGVUTNJZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.91 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |