C18H24ClNO2S — CID 46007278
1-(4-chlorophenoxy)-3-[2-methylpropyl(thiophen-3-ylmethyl)amino]propan-2-ol (PubChem CID 46007278) has the molecular formula C18H24ClNO2S and a molecular weight of 353.92 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3-[2-methylpropyl(thiophen-3-ylmethyl)amino]propan-2-ol.
| Compound Name | 1-(4-chlorophenoxy)-3-[2-methylpropyl(thiophen-3-ylmethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 46007278 |
| Molecular Formula | C18H24ClNO2S |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-(4-chlorophenoxy)-3-[2-methylpropyl(thiophen-3-ylmethyl)amino]propan-2-ol |
| SMILES | CC(C)CN(Cc1ccsc1)CC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClNO2S/c1-14(2)9-20(10-15-7-8-23-13-15)11-17(21)12-22-18-5-3-16(19)4-6-18/h3-8,13-14,17,21H,9-12H2,1-2H3 |
| InChIKey | TYKINCUGOYEAEL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |