C18H25NO2S — CID 42682271
1-[butan-2-yl(thiophen-3-ylmethyl)amino]-3-phenoxypropan-2-ol (PubChem CID 42682271) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is 1-[butan-2-yl(thiophen-3-ylmethyl)amino]-3-phenoxypropan-2-ol.
| Compound Name | 1-[butan-2-yl(thiophen-3-ylmethyl)amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 42682271 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-[butan-2-yl(thiophen-3-ylmethyl)amino]-3-phenoxypropan-2-ol |
| SMILES | CCC(C)N(Cc1ccsc1)CC(O)COc1ccccc1 |
| InChI | InChI=1S/C18H25NO2S/c1-3-15(2)19(11-16-9-10-22-14-16)12-17(20)13-21-18-7-5-4-6-8-18/h4-10,14-15,17,20H,3,11-13H2,1-2H3 |
| InChIKey | MAPZNZMWFKTVOB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |