C22H31NO3 — CID 24717348
1-[butan-2-yl-[(4-methylphenyl)methyl]amino]-3-(4-methoxyphenoxy)propan-2-ol (PubChem CID 24717348) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 1-[butan-2-yl-[(4-methylphenyl)methyl]amino]-3-(4-methoxyphenoxy)propan-2-ol.
| Compound Name | 1-[butan-2-yl-[(4-methylphenyl)methyl]amino]-3-(4-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 24717348 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1-[butan-2-yl-[(4-methylphenyl)methyl]amino]-3-(4-methoxyphenoxy)propan-2-ol |
| SMILES | CCC(C)N(Cc1ccc(C)cc1)CC(O)COc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H31NO3/c1-5-18(3)23(14-19-8-6-17(2)7-9-19)15-20(24)16-26-22-12-10-21(25-4)11-13-22/h6-13,18,20,24H,5,14-16H2,1-4H3 |
| InChIKey | BMEANQPHAINZRF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |