C19H33NO3 — CID 99729146
(2R)-1-[[(2R)-butan-2-yl]-[(4-methoxyphenyl)methyl]amino]-3-(2-methylpropoxy)propan-2-ol (PubChem CID 99729146) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is (2R)-1-[[(2R)-butan-2-yl]-[(4-methoxyphenyl)methyl]amino]-3-(2-methylpropoxy)propan-2-ol.
| Compound Name | (2R)-1-[[(2R)-butan-2-yl]-[(4-methoxyphenyl)methyl]amino]-3-(2-methylpropoxy)propan-2-ol |
|---|---|
| PubChem CID | 99729146 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | (2R)-1-[[(2R)-butan-2-yl]-[(4-methoxyphenyl)methyl]amino]-3-(2-methylpropoxy)propan-2-ol |
| SMILES | CC[C@@H](C)N(Cc1ccc(OC)cc1)C[C@@H](O)COCC(C)C |
| InChI | InChI=1S/C19H33NO3/c1-6-16(4)20(12-18(21)14-23-13-15(2)3)11-17-7-9-19(22-5)10-8-17/h7-10,15-16,18,21H,6,11-14H2,1-5H3/t16-,18-/m1/s1 |
| InChIKey | RJQNXULNKICSRK-SJLPKXTDSA-N |
| XLogP | 3.33 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |