C21H28ClNO2 — CID 99732489
(2R)-1-[[(2R)-butan-2-yl]-[(3-methylphenyl)methyl]amino]-3-(4-chlorophenoxy)propan-2-ol (PubChem CID 99732489) has the molecular formula C21H28ClNO2 and a molecular weight of 361.91 g/mol. Its IUPAC name is (2R)-1-[[(2R)-butan-2-yl]-[(3-methylphenyl)methyl]amino]-3-(4-chlorophenoxy)propan-2-ol.
| Compound Name | (2R)-1-[[(2R)-butan-2-yl]-[(3-methylphenyl)methyl]amino]-3-(4-chlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 99732489 |
| Molecular Formula | C21H28ClNO2 |
| Molecular Weight | 361.91 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (2R)-1-[[(2R)-butan-2-yl]-[(3-methylphenyl)methyl]amino]-3-(4-chlorophenoxy)propan-2-ol |
| SMILES | CC[C@@H](C)N(Cc1cccc(C)c1)C[C@@H](O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H28ClNO2/c1-4-17(3)23(13-18-7-5-6-16(2)12-18)14-20(24)15-25-21-10-8-19(22)9-11-21/h5-12,17,20,24H,4,13-15H2,1-3H3/t17-,20-/m1/s1 |
| InChIKey | IBJNXAISHPAMLM-YLJYHZDGSA-N |
| XLogP | 4.69 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |