C19H27NO3 — CID 93161850
(2S)-1-[[(2R)-butan-2-yl]-[(5-methylfuran-2-yl)methyl]amino]-3-phenoxypropan-2-ol (PubChem CID 93161850) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (2S)-1-[[(2R)-butan-2-yl]-[(5-methylfuran-2-yl)methyl]amino]-3-phenoxypropan-2-ol.
| Compound Name | (2S)-1-[[(2R)-butan-2-yl]-[(5-methylfuran-2-yl)methyl]amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 93161850 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (2S)-1-[[(2R)-butan-2-yl]-[(5-methylfuran-2-yl)methyl]amino]-3-phenoxypropan-2-ol |
| SMILES | CC[C@@H](C)N(Cc1ccc(C)o1)C[C@H](O)COc1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c1-4-15(2)20(13-19-11-10-16(3)23-19)12-17(21)14-22-18-8-6-5-7-9-18/h5-11,15,17,21H,4,12-14H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | CQJRVHSQODLXPZ-WBVHZDCISA-N |
| XLogP | 3.63 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |