C15H25NO2S — CID 93162458
(2S)-1-[2-methylpropyl(thiophen-3-ylmethyl)amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 93162458) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is (2S)-1-[2-methylpropyl(thiophen-3-ylmethyl)amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2S)-1-[2-methylpropyl(thiophen-3-ylmethyl)amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 93162458 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2S)-1-[2-methylpropyl(thiophen-3-ylmethyl)amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@@H](O)CN(Cc1ccsc1)CC(C)C |
| InChI | InChI=1S/C15H25NO2S/c1-4-6-18-11-15(17)10-16(8-13(2)3)9-14-5-7-19-12-14/h4-5,7,12-13,15,17H,1,6,8-11H2,2-3H3/t15-/m0/s1 |
| InChIKey | XJKWEVHGJUKFEP-HNNXBMFYSA-N |
| XLogP | 2.77 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|