C14H23NO2S — CID 24713676
1-prop-2-enoxy-3-[propyl(thiophen-3-ylmethyl)amino]propan-2-ol (PubChem CID 24713676) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-prop-2-enoxy-3-[propyl(thiophen-3-ylmethyl)amino]propan-2-ol.
| Compound Name | 1-prop-2-enoxy-3-[propyl(thiophen-3-ylmethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 24713676 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-prop-2-enoxy-3-[propyl(thiophen-3-ylmethyl)amino]propan-2-ol |
| SMILES | C=CCOCC(O)CN(CCC)Cc1ccsc1 |
| InChI | InChI=1S/C14H23NO2S/c1-3-6-15(9-13-5-8-18-12-13)10-14(16)11-17-7-4-2/h4-5,8,12,14,16H,2-3,6-7,9-11H2,1H3 |
| InChIKey | SQBCBWVQPMSIFA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|