C19H31NO2 — CID 93163167
(2R)-1-[3-methylbutyl-[(3-methylphenyl)methyl]amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 93163167) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is (2R)-1-[3-methylbutyl-[(3-methylphenyl)methyl]amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2R)-1-[3-methylbutyl-[(3-methylphenyl)methyl]amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 93163167 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | (2R)-1-[3-methylbutyl-[(3-methylphenyl)methyl]amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@H](O)CN(CCC(C)C)Cc1cccc(C)c1 |
| InChI | InChI=1S/C19H31NO2/c1-5-11-22-15-19(21)14-20(10-9-16(2)3)13-18-8-6-7-17(4)12-18/h5-8,12,16,19,21H,1,9-11,13-15H2,2-4H3/t19-/m1/s1 |
| InChIKey | VSCOAIZFSBQVKU-LJQANCHMSA-N |
| XLogP | 3.41 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|