C22H28FNO4 — CID 93161088
(2S)-1-[(3,4-dimethoxyphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 93161088) has the molecular formula C22H28FNO4 and a molecular weight of 389.47 g/mol. Its IUPAC name is (2S)-1-[(3,4-dimethoxyphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2S)-1-[(3,4-dimethoxyphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 93161088 |
| Molecular Formula | C22H28FNO4 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (2S)-1-[(3,4-dimethoxyphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@@H](O)CN(Cc1ccc(F)cc1)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H28FNO4/c1-4-11-28-16-20(25)15-24(13-17-5-8-19(23)9-6-17)14-18-7-10-21(26-2)22(12-18)27-3/h4-10,12,20,25H,1,11,13-16H2,2-3H3/t20-/m0/s1 |
| InChIKey | YXAZSRSCNATWIG-FQEVSTJZSA-N |
| XLogP | 3.41 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|