C20H24FNO2 — CID 93164335
(2S)-1-[benzyl-[(2-fluorophenyl)methyl]amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 93164335) has the molecular formula C20H24FNO2 and a molecular weight of 329.42 g/mol. Its IUPAC name is (2S)-1-[benzyl-[(2-fluorophenyl)methyl]amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2S)-1-[benzyl-[(2-fluorophenyl)methyl]amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 93164335 |
| Molecular Formula | C20H24FNO2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (2S)-1-[benzyl-[(2-fluorophenyl)methyl]amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@@H](O)CN(Cc1ccccc1)Cc1ccccc1F |
| InChI | InChI=1S/C20H24FNO2/c1-2-12-24-16-19(23)15-22(13-17-8-4-3-5-9-17)14-18-10-6-7-11-20(18)21/h2-11,19,23H,1,12-16H2/t19-/m0/s1 |
| InChIKey | PRCJPXINFFOSMH-IBGZPJMESA-N |
| XLogP | 3.39 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|