C18H26FNO3 — CID 129422627
(2S)-1-[(2-fluorophenyl)methyl-[[(2R)-oxolan-2-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 129422627) has the molecular formula C18H26FNO3 and a molecular weight of 323.41 g/mol. Its IUPAC name is (2S)-1-[(2-fluorophenyl)methyl-[[(2R)-oxolan-2-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2S)-1-[(2-fluorophenyl)methyl-[[(2R)-oxolan-2-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 129422627 |
| Molecular Formula | C18H26FNO3 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (2S)-1-[(2-fluorophenyl)methyl-[[(2R)-oxolan-2-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@@H](O)CN(Cc1ccccc1F)C[C@H]1CCCO1 |
| InChI | InChI=1S/C18H26FNO3/c1-2-9-22-14-16(21)12-20(13-17-7-5-10-23-17)11-15-6-3-4-8-18(15)19/h2-4,6,8,16-17,21H,1,5,7,9-14H2/t16-,17+/m0/s1 |
| InChIKey | DFTFQIMCPQICJV-DLBZAZTESA-N |
| XLogP | 2.37 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|