C22H29NO3 — CID 129428443
(2R)-1-[(2-methylphenyl)methyl-[[(2R)-oxolan-2-yl]methyl]amino]-3-phenoxypropan-2-ol (PubChem CID 129428443) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (2R)-1-[(2-methylphenyl)methyl-[[(2R)-oxolan-2-yl]methyl]amino]-3-phenoxypropan-2-ol.
| Compound Name | (2R)-1-[(2-methylphenyl)methyl-[[(2R)-oxolan-2-yl]methyl]amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 129428443 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (2R)-1-[(2-methylphenyl)methyl-[[(2R)-oxolan-2-yl]methyl]amino]-3-phenoxypropan-2-ol |
| SMILES | Cc1ccccc1CN(C[C@@H](O)COc1ccccc1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C22H29NO3/c1-18-8-5-6-9-19(18)14-23(16-22-12-7-13-25-22)15-20(24)17-26-21-10-3-2-4-11-21/h2-6,8-11,20,22,24H,7,12-17H2,1H3/t20-,22-/m1/s1 |
| InChIKey | MGYIPRROZHLWAZ-IFMALSPDSA-N |
| XLogP | 3.42 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |