C25H29NO3S — CID 18267024
1-[oxolan-2-ylmethyl(thiophen-2-ylmethyl)amino]-3-(4-phenylphenoxy)propan-2-ol (PubChem CID 18267024) has the molecular formula C25H29NO3S and a molecular weight of 423.58 g/mol. Its IUPAC name is 1-[oxolan-2-ylmethyl(thiophen-2-ylmethyl)amino]-3-(4-phenylphenoxy)propan-2-ol.
| Compound Name | 1-[oxolan-2-ylmethyl(thiophen-2-ylmethyl)amino]-3-(4-phenylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 18267024 |
| Molecular Formula | C25H29NO3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1-[oxolan-2-ylmethyl(thiophen-2-ylmethyl)amino]-3-(4-phenylphenoxy)propan-2-ol |
| SMILES | OC(COc1ccc(-c2ccccc2)cc1)CN(Cc1cccs1)CC1CCCO1 |
| InChI | InChI=1S/C25H29NO3S/c27-22(16-26(17-24-8-4-14-28-24)18-25-9-5-15-30-25)19-29-23-12-10-21(11-13-23)20-6-2-1-3-7-20/h1-3,5-7,9-13,15,22,24,27H,4,8,14,16-19H2 |
| InChIKey | KTYUZXKZGJUYAE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |