C21H26FNO3 — CID 93099028
(2S)-1-[(4-fluorophenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]-3-phenoxypropan-2-ol (PubChem CID 93099028) has the molecular formula C21H26FNO3 and a molecular weight of 359.44 g/mol. Its IUPAC name is (2S)-1-[(4-fluorophenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]-3-phenoxypropan-2-ol.
| Compound Name | (2S)-1-[(4-fluorophenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 93099028 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (2S)-1-[(4-fluorophenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]-3-phenoxypropan-2-ol |
| SMILES | O[C@H](COc1ccccc1)CN(Cc1ccc(F)cc1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C21H26FNO3/c22-18-10-8-17(9-11-18)13-23(15-21-7-4-12-25-21)14-19(24)16-26-20-5-2-1-3-6-20/h1-3,5-6,8-11,19,21,24H,4,7,12-16H2/t19-,21-/m0/s1 |
| InChIKey | JHVZWJLKIRYOHD-FPOVZHCZSA-N |
| XLogP | 3.25 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |