C16H23N3O2S — CID 98723804
(2R)-1-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]-3-pyrazol-1-ylpropan-2-ol (PubChem CID 98723804) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is (2R)-1-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]-3-pyrazol-1-ylpropan-2-ol.
| Compound Name | (2R)-1-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]-3-pyrazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 98723804 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (2R)-1-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]-3-pyrazol-1-ylpropan-2-ol |
| SMILES | O[C@H](CN(Cc1cccs1)C[C@@H]1CCCO1)Cn1cccn1 |
| InChI | InChI=1S/C16H23N3O2S/c20-14(11-19-7-3-6-17-19)10-18(12-15-4-1-8-21-15)13-16-5-2-9-22-16/h2-3,5-7,9,14-15,20H,1,4,8,10-13H2/t14-,15+/m1/s1 |
| InChIKey | CQGYLNQBQNXSED-CABCVRRESA-N |
| XLogP | 1.99 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |