C15H23NO3S — CID 111976537
[3-[[oxolan-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]oxetan-3-yl]methanol (PubChem CID 111976537) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is [3-[[oxolan-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]oxetan-3-yl]methanol.
| Compound Name | [3-[[oxolan-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]oxetan-3-yl]methanol |
|---|---|
| PubChem CID | 111976537 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [3-[[oxolan-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]oxetan-3-yl]methanol |
| SMILES | OCC1(CN(Cc2cccs2)CC2CCCO2)COC1 |
| InChI | InChI=1S/C15H23NO3S/c17-10-15(11-18-12-15)9-16(7-13-3-1-5-19-13)8-14-4-2-6-20-14/h2,4,6,13,17H,1,3,5,7-12H2 |
| InChIKey | GNJAADNDBHPEBC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |