C23H34N2O2S — CID 9055577
N-(1-adamantylmethyl)-2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide (PubChem CID 9055577) has the molecular formula C23H34N2O2S and a molecular weight of 402.60 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide.
| Compound Name | N-(1-adamantylmethyl)-2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 9055577 |
| Molecular Formula | C23H34N2O2S |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | N-(1-adamantylmethyl)-2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide |
| SMILES | O=C(CN(Cc1cccs1)C[C@H]1CCCO1)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H34N2O2S/c26-22(24-16-23-10-17-7-18(11-23)9-19(8-17)12-23)15-25(13-20-3-1-5-27-20)14-21-4-2-6-28-21/h2,4,6,17-20H,1,3,5,7-16H2,(H,24,26)/t17?,18?,19?,20-,23?/m1/s1 |
| InChIKey | GEAHXMUYBKHFSH-LIPMQLJGSA-N |
| XLogP | 4.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |