C16H25N3O3S — CID 9055471
2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]-N-(propylcarbamoyl)acetamide (PubChem CID 9055471) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]-N-(propylcarbamoyl)acetamide.
| Compound Name | 2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]-N-(propylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 9055471 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]-N-(propylcarbamoyl)acetamide |
| SMILES | CCCNC(=O)NC(=O)CN(Cc1cccs1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H25N3O3S/c1-2-7-17-16(21)18-15(20)12-19(10-13-5-3-8-22-13)11-14-6-4-9-23-14/h4,6,9,13H,2-3,5,7-8,10-12H2,1H3,(H2,17,18,20,21)/t13-/m0/s1 |
| InChIKey | PKTAFMTZCWYNGP-ZDUSSCGKSA-N |
| XLogP | 1.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |