C18H27N3O3S — CID 9055373
N-(cyclopentylcarbamoyl)-2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide (PubChem CID 9055373) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-(cyclopentylcarbamoyl)-2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide.
| Compound Name | N-(cyclopentylcarbamoyl)-2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 9055373 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-(cyclopentylcarbamoyl)-2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide |
| SMILES | O=C(CN(Cc1cccs1)C[C@@H]1CCCO1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H27N3O3S/c22-17(20-18(23)19-14-5-1-2-6-14)13-21(11-15-7-3-9-24-15)12-16-8-4-10-25-16/h4,8,10,14-15H,1-3,5-7,9,11-13H2,(H2,19,20,22,23)/t15-/m0/s1 |
| InChIKey | GRYQOMCLBLLSKP-HNNXBMFYSA-N |
| XLogP | 2.50 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |