C20H28FN3O3 — CID 49309235
N-(cyclopentylcarbamoyl)-2-[(3-fluorophenyl)methyl-(oxolan-2-ylmethyl)amino]acetamide (PubChem CID 49309235) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is N-(cyclopentylcarbamoyl)-2-[(3-fluorophenyl)methyl-(oxolan-2-ylmethyl)amino]acetamide.
| Compound Name | N-(cyclopentylcarbamoyl)-2-[(3-fluorophenyl)methyl-(oxolan-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 49309235 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-(cyclopentylcarbamoyl)-2-[(3-fluorophenyl)methyl-(oxolan-2-ylmethyl)amino]acetamide |
| SMILES | O=C(CN(Cc1cccc(F)c1)CC1CCCO1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H28FN3O3/c21-16-6-3-5-15(11-16)12-24(13-18-9-4-10-27-18)14-19(25)23-20(26)22-17-7-1-2-8-17/h3,5-6,11,17-18H,1-2,4,7-10,12-14H2,(H2,22,23,25,26) |
| InChIKey | UWOYDIHGFMOQTP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |