C20H24FNO — CID 60514059
N-[(3-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)-2-phenylethanamine (PubChem CID 60514059) has the molecular formula C20H24FNO and a molecular weight of 313.42 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)-2-phenylethanamine.
| Compound Name | N-[(3-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)-2-phenylethanamine |
|---|---|
| PubChem CID | 60514059 |
| Molecular Formula | C20H24FNO |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)-2-phenylethanamine |
| SMILES | Fc1cccc(CN(CCc2ccccc2)CC2CCCO2)c1 |
| InChI | InChI=1S/C20H24FNO/c21-19-9-4-8-18(14-19)15-22(16-20-10-5-13-23-20)12-11-17-6-2-1-3-7-17/h1-4,6-9,14,20H,5,10-13,15-16H2 |
| InChIKey | PYFDNSVKHDCERH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |