C23H33NO4 — CID 93162938
(2S)-1-(4-methoxyphenoxy)-3-[(3-methoxyphenyl)methyl-(3-methylbutyl)amino]propan-2-ol (PubChem CID 93162938) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is (2S)-1-(4-methoxyphenoxy)-3-[(3-methoxyphenyl)methyl-(3-methylbutyl)amino]propan-2-ol.
| Compound Name | (2S)-1-(4-methoxyphenoxy)-3-[(3-methoxyphenyl)methyl-(3-methylbutyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 93162938 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (2S)-1-(4-methoxyphenoxy)-3-[(3-methoxyphenyl)methyl-(3-methylbutyl)amino]propan-2-ol |
| SMILES | COc1ccc(OC[C@@H](O)CN(CCC(C)C)Cc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C23H33NO4/c1-18(2)12-13-24(15-19-6-5-7-23(14-19)27-4)16-20(25)17-28-22-10-8-21(26-3)9-11-22/h5-11,14,18,20,25H,12-13,15-17H2,1-4H3/t20-/m0/s1 |
| InChIKey | LGMMPCMRXAVVFG-FQEVSTJZSA-N |
| XLogP | 3.99 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |