C35H40Cl2O3 — CID 158398090
1-[(2S)-2-benzyl-3-methylbutoxy]-2,4-dichlorobenzene;(2S,3R)-3-benzyl-4-phenoxybutan-2-ol (PubChem CID 158398090) has the molecular formula C35H40Cl2O3 and a molecular weight of 579.61 g/mol. Its IUPAC name is 1-[(2S)-2-benzyl-3-methylbutoxy]-2,4-dichlorobenzene;(2S,3R)-3-benzyl-4-phenoxybutan-2-ol.
| Compound Name | 1-[(2S)-2-benzyl-3-methylbutoxy]-2,4-dichlorobenzene;(2S,3R)-3-benzyl-4-phenoxybutan-2-ol |
|---|---|
| PubChem CID | 158398090 |
| Molecular Formula | C35H40Cl2O3 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 1-[(2S)-2-benzyl-3-methylbutoxy]-2,4-dichlorobenzene;(2S,3R)-3-benzyl-4-phenoxybutan-2-ol |
| SMILES | CC(C)[C@@H](COc1ccc(Cl)cc1Cl)Cc1ccccc1.C[C@H](O)[C@@H](COc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H20Cl2O.C17H20O2/c1-13(2)15(10-14-6-4-3-5-7-14)12-21-18-9-8-16(19)11-17(18)20;1-14(18)16(12-15-8-4-2-5-9-15)13-19-17-10-6-3-7-11-17/h3-9,11,13,15H,10,12H2,1-2H3;2-11,14,16,18H,12-13H2,1H3/t15-;14-,16+/m10/s1 |
| InChIKey | GXTLAHYGSCOQSQ-UITCHCFUSA-N |
| XLogP | 9.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |