C16H24Cl2NO2+ — CID 7376022
cyclohexyl-[(2R)-3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-methylazanium (PubChem CID 7376022) has the molecular formula C16H24Cl2NO2+ and a molecular weight of 333.28 g/mol. Its IUPAC name is cyclohexyl-[(2R)-3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-methylazanium.
| Compound Name | cyclohexyl-[(2R)-3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-methylazanium |
|---|---|
| PubChem CID | 7376022 |
| Molecular Formula | C16H24Cl2NO2+ |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | cyclohexyl-[(2R)-3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-methylazanium |
| SMILES | C[NH+](C[C@@H](O)COc1ccc(Cl)cc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C16H23Cl2NO2/c1-19(13-5-3-2-4-6-13)10-14(20)11-21-16-8-7-12(17)9-15(16)18/h7-9,13-14,20H,2-6,10-11H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | RLVBTSREZWKFDM-CQSZACIVSA-O |
| XLogP | 2.58 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |