C20H28NO2+ — CID 6945163
cyclohexyl-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]-methylazanium (PubChem CID 6945163) has the molecular formula C20H28NO2+ and a molecular weight of 314.45 g/mol. Its IUPAC name is cyclohexyl-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]-methylazanium.
| Compound Name | cyclohexyl-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]-methylazanium |
|---|---|
| PubChem CID | 6945163 |
| Molecular Formula | C20H28NO2+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | cyclohexyl-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]-methylazanium |
| SMILES | C[NH+](C[C@@H](O)COc1ccc2ccccc2c1)C1CCCCC1 |
| InChI | InChI=1S/C20H27NO2/c1-21(18-9-3-2-4-10-18)14-19(22)15-23-20-12-11-16-7-5-6-8-17(16)13-20/h5-8,11-13,18-19,22H,2-4,9-10,14-15H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | PCEJUSXAMGFALJ-LJQANCHMSA-O |
| XLogP | 2.43 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |