C20H33N2O5S+ — CID 2331104
cyclohexyl-[(2R)-2-hydroxy-3-(4-morpholin-4-ylsulfonylphenoxy)propyl]-methylazanium (PubChem CID 2331104) has the molecular formula C20H33N2O5S+ and a molecular weight of 413.56 g/mol. Its IUPAC name is cyclohexyl-[(2R)-2-hydroxy-3-(4-morpholin-4-ylsulfonylphenoxy)propyl]-methylazanium.
| Compound Name | cyclohexyl-[(2R)-2-hydroxy-3-(4-morpholin-4-ylsulfonylphenoxy)propyl]-methylazanium |
|---|---|
| PubChem CID | 2331104 |
| Molecular Formula | C20H33N2O5S+ |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | cyclohexyl-[(2R)-2-hydroxy-3-(4-morpholin-4-ylsulfonylphenoxy)propyl]-methylazanium |
| SMILES | C[NH+](C[C@@H](O)COc1ccc(S(=O)(=O)N2CCOCC2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H32N2O5S/c1-21(17-5-3-2-4-6-17)15-18(23)16-27-19-7-9-20(10-8-19)28(24,25)22-11-13-26-14-12-22/h7-10,17-18,23H,2-6,11-16H2,1H3/p+1/t18-/m1/s1 |
| InChIKey | JAAWIAFOLYWFDX-GOSISDBHSA-O |
| XLogP | 0.29 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |