C21H28N2O5S — CID 2331078
(2R)-1-(4-morpholin-4-ylsulfonylphenoxy)-3-[[(1S)-1-phenylethyl]amino]propan-2-ol (PubChem CID 2331078) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is (2R)-1-(4-morpholin-4-ylsulfonylphenoxy)-3-[[(1S)-1-phenylethyl]amino]propan-2-ol.
| Compound Name | (2R)-1-(4-morpholin-4-ylsulfonylphenoxy)-3-[[(1S)-1-phenylethyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 2331078 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (2R)-1-(4-morpholin-4-ylsulfonylphenoxy)-3-[[(1S)-1-phenylethyl]amino]propan-2-ol |
| SMILES | C[C@H](NC[C@@H](O)COc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O5S/c1-17(18-5-3-2-4-6-18)22-15-19(24)16-28-20-7-9-21(10-8-20)29(25,26)23-11-13-27-14-12-23/h2-10,17,19,22,24H,11-16H2,1H3/t17-,19+/m0/s1 |
| InChIKey | DGUBEVHBQSTJMV-PKOBYXMFSA-N |
| XLogP | 1.80 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |