C19H25NO3 — CID 110020401
1-[3-(1-hydroxyethyl)pyrrolidin-1-yl]-3-naphthalen-2-yloxypropan-2-ol (PubChem CID 110020401) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 1-[3-(1-hydroxyethyl)pyrrolidin-1-yl]-3-naphthalen-2-yloxypropan-2-ol.
| Compound Name | 1-[3-(1-hydroxyethyl)pyrrolidin-1-yl]-3-naphthalen-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 110020401 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-[3-(1-hydroxyethyl)pyrrolidin-1-yl]-3-naphthalen-2-yloxypropan-2-ol |
| SMILES | CC(O)C1CCN(CC(O)COc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C19H25NO3/c1-14(21)17-8-9-20(11-17)12-18(22)13-23-19-7-6-15-4-2-3-5-16(15)10-19/h2-7,10,14,17-18,21-22H,8-9,11-13H2,1H3 |
| InChIKey | XYYKHTJTESBQOU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |