C17H20O6 — CID 87264086
1-O-(2-hydroxypentyl) 2-O-(2-methylprop-2-enoyl) benzene-1,2-dicarboxylate (PubChem CID 87264086) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 1-O-(2-hydroxypentyl) 2-O-(2-methylprop-2-enoyl) benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(2-hydroxypentyl) 2-O-(2-methylprop-2-enoyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 87264086 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-O-(2-hydroxypentyl) 2-O-(2-methylprop-2-enoyl) benzene-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OC(=O)c1ccccc1C(=O)OCC(O)CCC |
| InChI | InChI=1S/C17H20O6/c1-4-7-12(18)10-22-16(20)13-8-5-6-9-14(13)17(21)23-15(19)11(2)3/h5-6,8-9,12,18H,2,4,7,10H2,1,3H3 |
| InChIKey | VMTSBWHXRQJGIB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|