C23H26O4 — CID 175623983
1-O-(2-ethylpentyl) 2-O-(1-phenylethenyl) benzene-1,2-dicarboxylate (PubChem CID 175623983) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-O-(2-ethylpentyl) 2-O-(1-phenylethenyl) benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(2-ethylpentyl) 2-O-(1-phenylethenyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 175623983 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1-O-(2-ethylpentyl) 2-O-(1-phenylethenyl) benzene-1,2-dicarboxylate |
| SMILES | C=C(OC(=O)c1ccccc1C(=O)OCC(CC)CCC)c1ccccc1 |
| InChI | InChI=1S/C23H26O4/c1-4-11-18(5-2)16-26-22(24)20-14-9-10-15-21(20)23(25)27-17(3)19-12-7-6-8-13-19/h6-10,12-15,18H,3-5,11,16H2,1-2H3 |
| InChIKey | XRTBWHDFCOZJNY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|