About 2-propylpentyl 2-methylsulfanylbenzoate
2-propylpentyl 2-methylsulfanylbenzoate (PubChem CID 91724978) has the molecular formula C16H24O2S
and a molecular weight of 280.43 g/mol. Its IUPAC name is 2-propylpentyl 2-methylsulfanylbenzoate.
Molecular Properties
| Compound Name | 2-propylpentyl 2-methylsulfanylbenzoate |
| PubChem CID | 91724978 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-propylpentyl 2-methylsulfanylbenzoate |
| SMILES | CCCC(CCC)COC(=O)c1ccccc1SC |
| InChI | InChI=1S/C16H24O2S/c1-4-8-13(9-5-2)12-18-16(17)14-10-6-7-11-15(14)19-3/h6-7,10-11,13H,4-5,8-9,12H2,1-3H3 |
| InChIKey | DXBSTOAFUPWBMU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propylpentyl 2-methylsulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylpentyl 2-methylsulfanylbenzoate?
The IUPAC name of 2-propylpentyl 2-methylsulfanylbenzoate (CID 91724978) is 2-propylpentyl 2-methylsulfanylbenzoate.
What is the SMILES notation for 2-propylpentyl 2-methylsulfanylbenzoate?
The canonical SMILES for 2-propylpentyl 2-methylsulfanylbenzoate is CCCC(CCC)COC(=O)c1ccccc1SC.
What is the InChIKey of 2-propylpentyl 2-methylsulfanylbenzoate?
The InChIKey is DXBSTOAFUPWBMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O2S/c1-4-8-13(9-5-2)12-18-16(17)14-10-6-7-11-15(14)19-3/h6-7,10-11,13H,4-5,8-9,12H2,1-3H3.
What are the key properties of 2-propylpentyl 2-methylsulfanylbenzoate?
2-propylpentyl 2-methylsulfanylbenzoate has a molecular weight of 280.43 g/mol, XLogP of 4.78, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylpentyl 2-methylsulfanylbenzoate is sourced from PubChem (CID 91724978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).