C18H16O4S — CID 21162417
2-(7-methoxy-5-oxo-6H-benzo[b][1]benzothiepin-3-yl)propanoic acid (PubChem CID 21162417) has the molecular formula C18H16O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-(7-methoxy-5-oxo-6H-benzo[b][1]benzothiepin-3-yl)propanoic acid.
| Compound Name | 2-(7-methoxy-5-oxo-6H-benzo[b][1]benzothiepin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 21162417 |
| Molecular Formula | C18H16O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-(7-methoxy-5-oxo-6H-benzo[b][1]benzothiepin-3-yl)propanoic acid |
| SMILES | COc1cccc2c1CC(=O)c1cc(C(C)C(=O)O)ccc1S2 |
| InChI | InChI=1S/C18H16O4S/c1-10(18(20)21)11-6-7-17-12(8-11)14(19)9-13-15(22-2)4-3-5-16(13)23-17/h3-8,10H,9H2,1-2H3,(H,20,21) |
| InChIKey | NPYDNZJJFBXWHC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |