C23H28N2O5S — CID 67364326
2,6-diaminohexanoic acid;2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoic acid (PubChem CID 67364326) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoic acid.
| Compound Name | 2,6-diaminohexanoic acid;2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 67364326 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 2,6-diaminohexanoic acid;2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1ccc2c(c1)CC(=O)c1ccccc1S2.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C17H14O3S.C6H14N2O2/c1-10(17(19)20)11-6-7-15-12(8-11)9-14(18)13-4-2-3-5-16(13)21-15;7-4-2-1-3-5(8)6(9)10/h2-8,10H,9H2,1H3,(H,19,20);5H,1-4,7-8H2,(H,9,10) |
| InChIKey | FSODGSLZSXJYDY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|