C19H29ClN2O5 — CID 3047194
2-[3-chloro-4-(cyclopropylmethoxy)phenyl]propanoic acid;(2S)-2,6-diaminohexanoic acid (PubChem CID 3047194) has the molecular formula C19H29ClN2O5 and a molecular weight of 400.90 g/mol. Its IUPAC name is 2-[3-chloro-4-(cyclopropylmethoxy)phenyl]propanoic acid;(2S)-2,6-diaminohexanoic acid.
| Compound Name | 2-[3-chloro-4-(cyclopropylmethoxy)phenyl]propanoic acid;(2S)-2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 3047194 |
| Molecular Formula | C19H29ClN2O5 |
| Molecular Weight | 400.90 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[3-chloro-4-(cyclopropylmethoxy)phenyl]propanoic acid;(2S)-2,6-diaminohexanoic acid |
| SMILES | CC(C(=O)O)c1ccc(OCC2CC2)c(Cl)c1.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C13H15ClO3.C6H14N2O2/c1-8(13(15)16)10-4-5-12(11(14)6-10)17-7-9-2-3-9;7-4-2-1-3-5(8)6(9)10/h4-6,8-9H,2-3,7H2,1H3,(H,15,16);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | DDKPVGWXHMHCFO-ZSCHJXSPSA-N |
| XLogP | 2.84 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.90 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|