C25H28Br2O3 — CID 150261941
2,4-bis[3-bromo-4-(cyclopropylmethoxy)phenyl]pentan-3-one (PubChem CID 150261941) has the molecular formula C25H28Br2O3 and a molecular weight of 536.30 g/mol. Its IUPAC name is 2,4-bis[3-bromo-4-(cyclopropylmethoxy)phenyl]pentan-3-one.
| Compound Name | 2,4-bis[3-bromo-4-(cyclopropylmethoxy)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 150261941 |
| Molecular Formula | C25H28Br2O3 |
| Molecular Weight | 536.30 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | 2,4-bis[3-bromo-4-(cyclopropylmethoxy)phenyl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1ccc(OCC2CC2)c(Br)c1)c1ccc(OCC2CC2)c(Br)c1 |
| InChI | InChI=1S/C25H28Br2O3/c1-15(19-7-9-23(21(26)11-19)29-13-17-3-4-17)25(28)16(2)20-8-10-24(22(27)12-20)30-14-18-5-6-18/h7-12,15-18H,3-6,13-14H2,1-2H3 |
| InChIKey | GBSXANJIVXWQLU-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.30 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |