C17H22BrF2NO3 — CID 165416742
tert-butyl 3-[[2-bromo-4-(difluoromethyl)phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 165416742) has the molecular formula C17H22BrF2NO3 and a molecular weight of 406.27 g/mol. Its IUPAC name is tert-butyl 3-[[2-bromo-4-(difluoromethyl)phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-bromo-4-(difluoromethyl)phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 165416742 |
| Molecular Formula | C17H22BrF2NO3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | tert-butyl 3-[[2-bromo-4-(difluoromethyl)phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COc2ccc(C(F)F)cc2Br)C1 |
| InChI | InChI=1S/C17H22BrF2NO3/c1-17(2,3)24-16(22)21-7-6-11(9-21)10-23-14-5-4-12(15(19)20)8-13(14)18/h4-5,8,11,15H,6-7,9-10H2,1-3H3 |
| InChIKey | IYVOMANNUDIICN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |