C18H26BrNO3 — CID 118053135
tert-butyl 4-[(4-bromo-2-methylphenoxy)methyl]piperidine-1-carboxylate (PubChem CID 118053135) has the molecular formula C18H26BrNO3 and a molecular weight of 384.31 g/mol. Its IUPAC name is tert-butyl 4-[(4-bromo-2-methylphenoxy)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-bromo-2-methylphenoxy)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118053135 |
| Molecular Formula | C18H26BrNO3 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | tert-butyl 4-[(4-bromo-2-methylphenoxy)methyl]piperidine-1-carboxylate |
| SMILES | Cc1cc(Br)ccc1OCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H26BrNO3/c1-13-11-15(19)5-6-16(13)22-12-14-7-9-20(10-8-14)17(21)23-18(2,3)4/h5-6,11,14H,7-10,12H2,1-4H3 |
| InChIKey | FGACFKYKSIRACX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |