C24H31N3O6 — CID 174881683
2,6-diaminohexanoic acid;2-(9H-fluoren-1-ylmethoxycarbonylamino)propanoic acid (PubChem CID 174881683) has the molecular formula C24H31N3O6 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;2-(9H-fluoren-1-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 2,6-diaminohexanoic acid;2-(9H-fluoren-1-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 174881683 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 2,6-diaminohexanoic acid;2-(9H-fluoren-1-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CC(NC(=O)OCc1cccc2c1Cc1ccccc1-2)C(=O)O.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C18H17NO4.C6H14N2O2/c1-11(17(20)21)19-18(22)23-10-13-6-4-8-15-14-7-3-2-5-12(14)9-16(13)15;7-4-2-1-3-5(8)6(9)10/h2-8,11H,9-10H2,1H3,(H,19,22)(H,20,21);5H,1-4,7-8H2,(H,9,10) |
| InChIKey | YYYZSXJBILOPSI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 164.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|